Hangzhou Leap Chem Co., Ltd. is one of the most professional manufacturers and suppliers of pentafluorophenyl trifluoroacetate丨cas 14533-84-7 in China. Welcome to wholesale bulk high quality chemical products at competitive price from our factory. If you have any enquiry about custom service, please feel free to email us.
Best Supplier Pentafluorophenyl Trifluoroacetate丨CAS 14533-84-7
Pentafluorophenyl trifluoroacetate is a fluorinated organic compound containing a pentafluorophenyl group and a trifluoroacetate functionality. Its electron-deficient aromatic structure and fluorinated functional groups make it relevant to specialized organic synthesis and fluorine-containing chemical research. This compound may be used in selected synthetic applications involving activated ester chemistry and fluorinated intermediates, depending on the target transformation and reaction conditions.
Chemical Identifiers
| InChI | InChI=1S/C8F8O2/c9-1-2(10)4(12)6(5(13)3(1)11)18-7(17)8(14,15)16 |
| InChI Key | VCQURUZYYSOUHP-UHFFFAOYSA-N |
| Smiles | C1(=C(C(=C(C(=C1F)F)F)F)F)OC(=O)C(F)(F)F |
| EC No. | 629-320-4 |
| MDL No. | MFCD00134438 |
| PubChem CID | 4327891 |
Applications
Activated Ester Chemistry and Functional Group Modification
Pentafluorophenyl-containing compounds are relevant to activated ester chemistry because the electron-withdrawing fluorine substituents can influence the reactivity of associated functional groups. Depending on the reaction design, pentafluorophenyl trifluoroacetate may be investigated in specialized transformations involving acyl-related chemistry and the preparation of functionalized organic intermediates.
Pharmaceutical Research and Drug Discovery
Fluorine-containing groups are frequently investigated in medicinal chemistry because fluorination can influence molecular properties such as lipophilicity, metabolic stability, and electronic behavior. Pentafluorophenyl trifluoroacetate may be considered in selected research-stage synthetic routes involving fluorinated molecules or activated derivatives, although its specific role depends on the intended compound and validated reaction methodology.
Organic Synthesis and Fluorinated Intermediates
Materials Science and Specialty Chemical Research
Fluorinated compounds are studied in the development of advanced materials because fluorination can affect chemical stability, surface properties, and interactions with other materials. Pentafluorophenyl trifluoroacetate may support exploratory research involving fluorinated molecular structures and specialty intermediates, depending on the intended material and synthetic pathway.
